About (7-ethyl-2-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-1-yl)methanol
(7-ethyl-2-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-1-yl)methanol (PubChem CID 88580761) has the molecular formula C11H18O4S
and a molecular weight of 246.33 g/mol. Its IUPAC name is (7-ethyl-2-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-1-yl)methanol.
Molecular Properties
| Compound Name | (7-ethyl-2-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-1-yl)methanol |
| PubChem CID | 88580761 |
| Molecular Formula | C11H18O4S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | (7-ethyl-2-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-1-yl)methanol |
| SMILES | CCC12CC3(CO)CC1S(=O)(=O)OC2C3C |
| InChI | InChI=1S/C11H18O4S/c1-3-11-5-10(6-12)4-8(11)16(13,14)15-9(11)7(10)2/h7-9,12H,3-6H2,1-2H3 |
| InChIKey | ZFBINIVHMRWPNS-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (7-ethyl-2-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-1-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-ethyl-2-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-1-yl)methanol?
The IUPAC name of (7-ethyl-2-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-1-yl)methanol (CID 88580761) is (7-ethyl-2-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-1-yl)methanol.
What is the SMILES notation for (7-ethyl-2-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-1-yl)methanol?
The canonical SMILES for (7-ethyl-2-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-1-yl)methanol is CCC12CC3(CO)CC1S(=O)(=O)OC2C3C.
What is the InChIKey of (7-ethyl-2-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-1-yl)methanol?
The InChIKey is ZFBINIVHMRWPNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O4S/c1-3-11-5-10(6-12)4-8(11)16(13,14)15-9(11)7(10)2/h7-9,12H,3-6H2,1-2H3.
What are the key properties of (7-ethyl-2-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-1-yl)methanol?
(7-ethyl-2-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-1-yl)methanol has a molecular weight of 246.33 g/mol, XLogP of 0.90, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7-ethyl-2-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-1-yl)methanol is sourced from PubChem (CID 88580761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).