C16H18ClN3 — CID 88580786
2-chloro-4-cyclohexa-1,3-dien-1-yl-6-[(4Z)-hepta-4,6-dien-3-yl]-1,3,5-triazine (PubChem CID 88580786) has the molecular formula C16H18ClN3 and a molecular weight of 287.79 g/mol. Its IUPAC name is 2-chloro-4-cyclohexa-1,3-dien-1-yl-6-[(4Z)-hepta-4,6-dien-3-yl]-1,3,5-triazine.
| Compound Name | 2-chloro-4-cyclohexa-1,3-dien-1-yl-6-[(4Z)-hepta-4,6-dien-3-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 88580786 |
| Molecular Formula | C16H18ClN3 |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 2-chloro-4-cyclohexa-1,3-dien-1-yl-6-[(4Z)-hepta-4,6-dien-3-yl]-1,3,5-triazine |
| SMILES | C=C/C=C\C(CC)c1nc(Cl)nc(C2=CC=CCC2)n1 |
| InChI | InChI=1S/C16H18ClN3/c1-3-5-9-12(4-2)14-18-15(20-16(17)19-14)13-10-7-6-8-11-13/h3,5-7,9-10,12H,1,4,8,11H2,2H3/b9-5- |
| InChIKey | JCRWRVQWNZDJMP-UITAMQMPSA-N |
| XLogP | 4.49 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|