About 2-thiophosphorosopentane
2-thiophosphorosopentane (PubChem CID 88580916) has the molecular formula C5H11PS
and a molecular weight of 134.18 g/mol. Its IUPAC name is 2-thiophosphorosopentane.
Molecular Properties
| Compound Name | 2-thiophosphorosopentane |
| PubChem CID | 88580916 |
| Molecular Formula | C5H11PS |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.03 |
| IUPAC Name | 2-thiophosphorosopentane |
| SMILES | CCCC(C)P=S |
| InChI | InChI=1S/C5H11PS/c1-3-4-5(2)6-7/h5H,3-4H2,1-2H3 |
| InChIKey | VIGDEHKLTYJHLG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-thiophosphorosopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thiophosphorosopentane?
The IUPAC name of 2-thiophosphorosopentane (CID 88580916) is 2-thiophosphorosopentane.
What is the SMILES notation for 2-thiophosphorosopentane?
The canonical SMILES for 2-thiophosphorosopentane is CCCC(C)P=S.
What is the InChIKey of 2-thiophosphorosopentane?
The InChIKey is VIGDEHKLTYJHLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11PS/c1-3-4-5(2)6-7/h5H,3-4H2,1-2H3.
What are the key properties of 2-thiophosphorosopentane?
2-thiophosphorosopentane has a molecular weight of 134.18 g/mol, XLogP of 2.58, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thiophosphorosopentane is sourced from PubChem (CID 88580916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).