About (3Z,5Z)-5-hydroxy-4-methyl-2-methylidenehepta-3,5-dienenitrile
(3Z,5Z)-5-hydroxy-4-methyl-2-methylidenehepta-3,5-dienenitrile (PubChem CID 88580927) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is (3Z,5Z)-5-hydroxy-4-methyl-2-methylidenehepta-3,5-dienenitrile.
Molecular Properties
| Compound Name | (3Z,5Z)-5-hydroxy-4-methyl-2-methylidenehepta-3,5-dienenitrile |
| PubChem CID | 88580927 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | (3Z,5Z)-5-hydroxy-4-methyl-2-methylidenehepta-3,5-dienenitrile |
| SMILES | C=C(C#N)/C=C(C)\C(O)=C\C |
| InChI | InChI=1S/C9H11NO/c1-4-9(11)8(3)5-7(2)6-10/h4-5,11H,2H2,1,3H3/b8-5-,9-4- |
| InChIKey | PMMKZDDAOPVNAW-QWUBYWPLSA-N |
| XLogP | 2.47 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z,5Z)-5-hydroxy-4-methyl-2-methylidenehepta-3,5-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,5Z)-5-hydroxy-4-methyl-2-methylidenehepta-3,5-dienenitrile?
The IUPAC name of (3Z,5Z)-5-hydroxy-4-methyl-2-methylidenehepta-3,5-dienenitrile (CID 88580927) is (3Z,5Z)-5-hydroxy-4-methyl-2-methylidenehepta-3,5-dienenitrile.
What is the SMILES notation for (3Z,5Z)-5-hydroxy-4-methyl-2-methylidenehepta-3,5-dienenitrile?
The canonical SMILES for (3Z,5Z)-5-hydroxy-4-methyl-2-methylidenehepta-3,5-dienenitrile is C=C(C#N)/C=C(C)\C(O)=C\C.
What is the InChIKey of (3Z,5Z)-5-hydroxy-4-methyl-2-methylidenehepta-3,5-dienenitrile?
The InChIKey is PMMKZDDAOPVNAW-QWUBYWPLSA-N. The full InChI is InChI=1S/C9H11NO/c1-4-9(11)8(3)5-7(2)6-10/h4-5,11H,2H2,1,3H3/b8-5-,9-4-.
What are the key properties of (3Z,5Z)-5-hydroxy-4-methyl-2-methylidenehepta-3,5-dienenitrile?
(3Z,5Z)-5-hydroxy-4-methyl-2-methylidenehepta-3,5-dienenitrile has a molecular weight of 149.19 g/mol, XLogP of 2.47, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,5Z)-5-hydroxy-4-methyl-2-methylidenehepta-3,5-dienenitrile is sourced from PubChem (CID 88580927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).