C21H26N2O2 — CID 88581050
6-[4-(2-amino-2-methylpropyl)phenyl]-N-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxamide (PubChem CID 88581050) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 6-[4-(2-amino-2-methylpropyl)phenyl]-N-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxamide.
| Compound Name | 6-[4-(2-amino-2-methylpropyl)phenyl]-N-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 88581050 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 6-[4-(2-amino-2-methylpropyl)phenyl]-N-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
| SMILES | CC(C)(N)Cc1ccc(C2CCc3cc(C(=O)NO)ccc3C2)cc1 |
| InChI | InChI=1S/C21H26N2O2/c1-21(2,22)13-14-3-5-15(6-4-14)16-7-8-18-12-19(20(24)23-25)10-9-17(18)11-16/h3-6,9-10,12,16,25H,7-8,11,13,22H2,1-2H3,(H,23,24) |
| InChIKey | VLPMXTQYZNRYDC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|