C27H44N4O4S2 — CID 88581282
2,12-bis(3-ethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl)-2,4,10,12-tetramethyltridecane-5,9-dione (PubChem CID 88581282) has the molecular formula C27H44N4O4S2 and a molecular weight of 552.81 g/mol. Its IUPAC name is 2,12-bis(3-ethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl)-2,4,10,12-tetramethyltridecane-5,9-dione.
| Compound Name | 2,12-bis(3-ethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl)-2,4,10,12-tetramethyltridecane-5,9-dione |
|---|---|
| PubChem CID | 88581282 |
| Molecular Formula | C27H44N4O4S2 |
| Molecular Weight | 552.81 g/mol |
| Exact Mass | 552.28 |
| IUPAC Name | 2,12-bis(3-ethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl)-2,4,10,12-tetramethyltridecane-5,9-dione |
| SMILES | CCN1CC(=O)N(C(C)(C)CC(C)C(=O)CCCC(=O)C(C)CC(C)(C)N2C(=O)CN(CC)C2=S)C1=S |
| InChI | InChI=1S/C27H44N4O4S2/c1-9-28-16-22(34)30(24(28)36)26(5,6)14-18(3)20(32)12-11-13-21(33)19(4)15-27(7,8)31-23(35)17-29(10-2)25(31)37/h18-19H,9-17H2,1-8H3 |
| InChIKey | UOFKAGNCRZOXNW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.81 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|