C27H29F6NO3 — CID 88581306
(2E,5S,8R)-2-[5-[[3,5-bis(trifluoromethyl)-2-pyridinyl]oxy]-2-ethylphenyl]-3-hydroxy-4,5,8-trimethylcyclonon-2-en-1-one (PubChem CID 88581306) has the molecular formula C27H29F6NO3 and a molecular weight of 529.52 g/mol. Its IUPAC name is (2E,5S,8R)-2-[5-[[3,5-bis(trifluoromethyl)-2-pyridinyl]oxy]-2-ethylphenyl]-3-hydroxy-4,5,8-trimethylcyclonon-2-en-1-one.
| Compound Name | (2E,5S,8R)-2-[5-[[3,5-bis(trifluoromethyl)-2-pyridinyl]oxy]-2-ethylphenyl]-3-hydroxy-4,5,8-trimethylcyclonon-2-en-1-one |
|---|---|
| PubChem CID | 88581306 |
| Molecular Formula | C27H29F6NO3 |
| Molecular Weight | 529.52 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | (2E,5S,8R)-2-[5-[[3,5-bis(trifluoromethyl)-2-pyridinyl]oxy]-2-ethylphenyl]-3-hydroxy-4,5,8-trimethylcyclonon-2-en-1-one |
| SMILES | CCc1ccc(Oc2ncc(C(F)(F)F)cc2C(F)(F)F)cc1/C1=C(\O)C(C)[C@@H](C)CC[C@@H](C)CC1=O |
| InChI | InChI=1S/C27H29F6NO3/c1-5-17-8-9-19(37-25-21(27(31,32)33)11-18(13-34-25)26(28,29)30)12-20(17)23-22(35)10-14(2)6-7-15(3)16(4)24(23)36/h8-9,11-16,36H,5-7,10H2,1-4H3/b24-23+/t14-,15+,16?/m1/s1 |
| InChIKey | BJSMNRMCMZKYAV-ILCXKXNYSA-N |
| XLogP | 8.40 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.52 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |