About (3Z)-3-[(2Z)-3-methylpenta-2,4-dienylidene]thiophene
(3Z)-3-[(2Z)-3-methylpenta-2,4-dienylidene]thiophene (PubChem CID 88581324) has the molecular formula C10H12S
and a molecular weight of 164.27 g/mol. Its IUPAC name is (3Z)-3-[(2Z)-3-methylpenta-2,4-dienylidene]thiophene.
Molecular Properties
| Compound Name | (3Z)-3-[(2Z)-3-methylpenta-2,4-dienylidene]thiophene |
| PubChem CID | 88581324 |
| Molecular Formula | C10H12S |
| Molecular Weight | 164.27 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | (3Z)-3-[(2Z)-3-methylpenta-2,4-dienylidene]thiophene |
| SMILES | C=C/C(C)=C\C=C1\C=CSC1 |
| InChI | InChI=1S/C10H12S/c1-3-9(2)4-5-10-6-7-11-8-10/h3-7H,1,8H2,2H3/b9-4-,10-5- |
| InChIKey | GSCZMQCALVOQMA-AVWDGMTFSA-N |
| XLogP | 3.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.27 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-[(2Z)-3-methylpenta-2,4-dienylidene]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-[(2Z)-3-methylpenta-2,4-dienylidene]thiophene?
The IUPAC name of (3Z)-3-[(2Z)-3-methylpenta-2,4-dienylidene]thiophene (CID 88581324) is (3Z)-3-[(2Z)-3-methylpenta-2,4-dienylidene]thiophene.
What is the SMILES notation for (3Z)-3-[(2Z)-3-methylpenta-2,4-dienylidene]thiophene?
The canonical SMILES for (3Z)-3-[(2Z)-3-methylpenta-2,4-dienylidene]thiophene is C=C/C(C)=C\C=C1\C=CSC1.
What is the InChIKey of (3Z)-3-[(2Z)-3-methylpenta-2,4-dienylidene]thiophene?
The InChIKey is GSCZMQCALVOQMA-AVWDGMTFSA-N. The full InChI is InChI=1S/C10H12S/c1-3-9(2)4-5-10-6-7-11-8-10/h3-7H,1,8H2,2H3/b9-4-,10-5-.
What are the key properties of (3Z)-3-[(2Z)-3-methylpenta-2,4-dienylidene]thiophene?
(3Z)-3-[(2Z)-3-methylpenta-2,4-dienylidene]thiophene has a molecular weight of 164.27 g/mol, XLogP of 3.31, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-[(2Z)-3-methylpenta-2,4-dienylidene]thiophene is sourced from PubChem (CID 88581324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).