About 1-cyclopenta-1,4-dien-1-ylthiolan-1-ium
1-cyclopenta-1,4-dien-1-ylthiolan-1-ium (PubChem CID 88581533) has the molecular formula C9H13S+
and a molecular weight of 153.27 g/mol. Its IUPAC name is 1-cyclopenta-1,4-dien-1-ylthiolan-1-ium.
Molecular Properties
| Compound Name | 1-cyclopenta-1,4-dien-1-ylthiolan-1-ium |
| PubChem CID | 88581533 |
| Molecular Formula | C9H13S+ |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.07 |
| IUPAC Name | 1-cyclopenta-1,4-dien-1-ylthiolan-1-ium |
| SMILES | C1=CC([S+]2CCCC2)=CC1 |
| InChI | InChI=1S/C9H13S/c1-2-6-9(5-1)10-7-3-4-8-10/h1,5-6H,2-4,7-8H2/q+1 |
| InChIKey | UMZMHZUNSPUBND-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopenta-1,4-dien-1-ylthiolan-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopenta-1,4-dien-1-ylthiolan-1-ium?
The IUPAC name of 1-cyclopenta-1,4-dien-1-ylthiolan-1-ium (CID 88581533) is 1-cyclopenta-1,4-dien-1-ylthiolan-1-ium.
What is the SMILES notation for 1-cyclopenta-1,4-dien-1-ylthiolan-1-ium?
The canonical SMILES for 1-cyclopenta-1,4-dien-1-ylthiolan-1-ium is C1=CC([S+]2CCCC2)=CC1.
What is the InChIKey of 1-cyclopenta-1,4-dien-1-ylthiolan-1-ium?
The InChIKey is UMZMHZUNSPUBND-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13S/c1-2-6-9(5-1)10-7-3-4-8-10/h1,5-6H,2-4,7-8H2/q+1.
What are the key properties of 1-cyclopenta-1,4-dien-1-ylthiolan-1-ium?
1-cyclopenta-1,4-dien-1-ylthiolan-1-ium has a molecular weight of 153.27 g/mol, XLogP of 2.24, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopenta-1,4-dien-1-ylthiolan-1-ium is sourced from PubChem (CID 88581533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).