C17H24O2 — CID 88581597
5-[1-[(3Z,5Z)-3-ethenylhepta-3,5-dienoxy]ethoxy]cyclohexa-1,3-diene (PubChem CID 88581597) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is 5-[1-[(3Z,5Z)-3-ethenylhepta-3,5-dienoxy]ethoxy]cyclohexa-1,3-diene.
| Compound Name | 5-[1-[(3Z,5Z)-3-ethenylhepta-3,5-dienoxy]ethoxy]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 88581597 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 5-[1-[(3Z,5Z)-3-ethenylhepta-3,5-dienoxy]ethoxy]cyclohexa-1,3-diene |
| SMILES | C=C/C(=C\C=C/C)CCOC(C)OC1C=CC=CC1 |
| InChI | InChI=1S/C17H24O2/c1-4-6-10-16(5-2)13-14-18-15(3)19-17-11-8-7-9-12-17/h4-11,15,17H,2,12-14H2,1,3H3/b6-4-,16-10+ |
| InChIKey | QSVPYLLRICUGSY-OGTPZPDLSA-N |
| XLogP | 4.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|