C28H26S2 — CID 88581669
9,19-ditert-butyl-3,13-dithiahexacyclo[9.9.2.02,6.07,22.012,16.017,21]docosa-1(20),2(6),4,7(22),8,10,12(16),14,17(21),18-decaene (PubChem CID 88581669) has the molecular formula C28H26S2 and a molecular weight of 426.65 g/mol. Its IUPAC name is 9,19-ditert-butyl-3,13-dithiahexacyclo[9.9.2.02,6.07,22.012,16.017,21]docosa-1(20),2(6),4,7(22),8,10,12(16),14,17(21),18-decaene.
| Compound Name | 9,19-ditert-butyl-3,13-dithiahexacyclo[9.9.2.02,6.07,22.012,16.017,21]docosa-1(20),2(6),4,7(22),8,10,12(16),14,17(21),18-decaene |
|---|---|
| PubChem CID | 88581669 |
| Molecular Formula | C28H26S2 |
| Molecular Weight | 426.65 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 9,19-ditert-butyl-3,13-dithiahexacyclo[9.9.2.02,6.07,22.012,16.017,21]docosa-1(20),2(6),4,7(22),8,10,12(16),14,17(21),18-decaene |
| SMILES | CC(C)(C)c1cc2c3ccsc3c3cc(C(C)(C)C)cc4c5ccsc5c(c1)c2c43 |
| InChI | InChI=1S/C28H26S2/c1-27(2,3)15-11-19-17-7-9-30-26(17)22-14-16(28(4,5)6)12-20-18-8-10-29-25(18)21(13-15)23(19)24(20)22/h7-14H,1-6H3 |
| InChIKey | BCKVUJOLSFDFDB-UHFFFAOYSA-N |
| XLogP | 9.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.65 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|