About (5-chloro-2,3-dihydro-1-benzothiophen-3-yl)methanesulfonic acid
(5-chloro-2,3-dihydro-1-benzothiophen-3-yl)methanesulfonic acid (PubChem CID 88581736) has the molecular formula C9H9ClO3S2
and a molecular weight of 264.75 g/mol. Its IUPAC name is (5-chloro-2,3-dihydro-1-benzothiophen-3-yl)methanesulfonic acid.
Molecular Properties
| Compound Name | (5-chloro-2,3-dihydro-1-benzothiophen-3-yl)methanesulfonic acid |
| PubChem CID | 88581736 |
| Molecular Formula | C9H9ClO3S2 |
| Molecular Weight | 264.75 g/mol |
| Exact Mass | 263.97 |
| IUPAC Name | (5-chloro-2,3-dihydro-1-benzothiophen-3-yl)methanesulfonic acid |
| SMILES | O=S(=O)(O)CC1CSc2ccc(Cl)cc21 |
| InChI | InChI=1S/C9H9ClO3S2/c10-7-1-2-9-8(3-7)6(4-14-9)5-15(11,12)13/h1-3,6H,4-5H2,(H,11,12,13) |
| InChIKey | OCJQPDPAKGZXQX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.75 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze (5-chloro-2,3-dihydro-1-benzothiophen-3-yl)methanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chloro-2,3-dihydro-1-benzothiophen-3-yl)methanesulfonic acid?
The IUPAC name of (5-chloro-2,3-dihydro-1-benzothiophen-3-yl)methanesulfonic acid (CID 88581736) is (5-chloro-2,3-dihydro-1-benzothiophen-3-yl)methanesulfonic acid.
What is the SMILES notation for (5-chloro-2,3-dihydro-1-benzothiophen-3-yl)methanesulfonic acid?
The canonical SMILES for (5-chloro-2,3-dihydro-1-benzothiophen-3-yl)methanesulfonic acid is O=S(=O)(O)CC1CSc2ccc(Cl)cc21.
What is the InChIKey of (5-chloro-2,3-dihydro-1-benzothiophen-3-yl)methanesulfonic acid?
The InChIKey is OCJQPDPAKGZXQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClO3S2/c10-7-1-2-9-8(3-7)6(4-14-9)5-15(11,12)13/h1-3,6H,4-5H2,(H,11,12,13).
What are the key properties of (5-chloro-2,3-dihydro-1-benzothiophen-3-yl)methanesulfonic acid?
(5-chloro-2,3-dihydro-1-benzothiophen-3-yl)methanesulfonic acid has a molecular weight of 264.75 g/mol, XLogP of 2.42, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloro-2,3-dihydro-1-benzothiophen-3-yl)methanesulfonic acid is sourced from PubChem (CID 88581736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).