C17H23BN2O2 — CID 88582069
N'-[(1Z)-buta-1,3-dienyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenecarboximidamide (PubChem CID 88582069) has the molecular formula C17H23BN2O2 and a molecular weight of 298.20 g/mol. Its IUPAC name is N'-[(1Z)-buta-1,3-dienyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenecarboximidamide.
| Compound Name | N'-[(1Z)-buta-1,3-dienyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 88582069 |
| Molecular Formula | C17H23BN2O2 |
| Molecular Weight | 298.20 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | N'-[(1Z)-buta-1,3-dienyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenecarboximidamide |
| SMILES | C=C/C=C\N=C(/N)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C17H23BN2O2/c1-6-7-12-20-15(19)13-8-10-14(11-9-13)18-21-16(2,3)17(4,5)22-18/h6-12H,1H2,2-5H3,(H2,19,20)/b12-7- |
| InChIKey | YOVZKJVHTVKBMO-GHXNOFRVSA-N |
| XLogP | 2.39 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.20 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|