About 1-tert-butyl-3-(2,2-difluorobutyl)urea
1-tert-butyl-3-(2,2-difluorobutyl)urea (PubChem CID 88582203) has the molecular formula C9H18F2N2O
and a molecular weight of 208.25 g/mol. Its IUPAC name is 1-tert-butyl-3-(2,2-difluorobutyl)urea.
Molecular Properties
| Compound Name | 1-tert-butyl-3-(2,2-difluorobutyl)urea |
| PubChem CID | 88582203 |
| Molecular Formula | C9H18F2N2O |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | 1-tert-butyl-3-(2,2-difluorobutyl)urea |
| SMILES | CCC(F)(F)CNC(=O)NC(C)(C)C |
| InChI | InChI=1S/C9H18F2N2O/c1-5-9(10,11)6-12-7(14)13-8(2,3)4/h5-6H2,1-4H3,(H2,12,13,14) |
| InChIKey | ULPIZODUXAFKLT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-tert-butyl-3-(2,2-difluorobutyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-3-(2,2-difluorobutyl)urea?
The IUPAC name of 1-tert-butyl-3-(2,2-difluorobutyl)urea (CID 88582203) is 1-tert-butyl-3-(2,2-difluorobutyl)urea.
What is the SMILES notation for 1-tert-butyl-3-(2,2-difluorobutyl)urea?
The canonical SMILES for 1-tert-butyl-3-(2,2-difluorobutyl)urea is CCC(F)(F)CNC(=O)NC(C)(C)C.
What is the InChIKey of 1-tert-butyl-3-(2,2-difluorobutyl)urea?
The InChIKey is ULPIZODUXAFKLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18F2N2O/c1-5-9(10,11)6-12-7(14)13-8(2,3)4/h5-6H2,1-4H3,(H2,12,13,14).
What are the key properties of 1-tert-butyl-3-(2,2-difluorobutyl)urea?
1-tert-butyl-3-(2,2-difluorobutyl)urea has a molecular weight of 208.25 g/mol, XLogP of 2.13, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-3-(2,2-difluorobutyl)urea is sourced from PubChem (CID 88582203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).