C34H38N4O5 — CID 88582328
tert-butyl N-[1-[4-[7-(oxan-2-yloxycarbamoyl)-3-phenylimidazo[1,2-a]pyridin-2-yl]phenyl]cyclobutyl]carbamate (PubChem CID 88582328) has the molecular formula C34H38N4O5 and a molecular weight of 582.70 g/mol. Its IUPAC name is tert-butyl N-[1-[4-[7-(oxan-2-yloxycarbamoyl)-3-phenylimidazo[1,2-a]pyridin-2-yl]phenyl]cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[1-[4-[7-(oxan-2-yloxycarbamoyl)-3-phenylimidazo[1,2-a]pyridin-2-yl]phenyl]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 88582328 |
| Molecular Formula | C34H38N4O5 |
| Molecular Weight | 582.70 g/mol |
| Exact Mass | 582.28 |
| IUPAC Name | tert-butyl N-[1-[4-[7-(oxan-2-yloxycarbamoyl)-3-phenylimidazo[1,2-a]pyridin-2-yl]phenyl]cyclobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(c2ccc(-c3nc4cc(C(=O)NOC5CCCCO5)ccn4c3-c3ccccc3)cc2)CCC1 |
| InChI | InChI=1S/C34H38N4O5/c1-33(2,3)42-32(40)36-34(18-9-19-34)26-15-13-23(14-16-26)29-30(24-10-5-4-6-11-24)38-20-17-25(22-27(38)35-29)31(39)37-43-28-12-7-8-21-41-28/h4-6,10-11,13-17,20,22,28H,7-9,12,18-19,21H2,1-3H3,(H,36,40)(H,37,39) |
| InChIKey | AZPYOCIPURXLCL-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.70 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|