C25H54N2 — CID 88582342
4,4,8,12,16,16-hexamethylnonadecane-2,18-diamine (PubChem CID 88582342) has the molecular formula C25H54N2 and a molecular weight of 382.72 g/mol. Its IUPAC name is 4,4,8,12,16,16-hexamethylnonadecane-2,18-diamine.
| Compound Name | 4,4,8,12,16,16-hexamethylnonadecane-2,18-diamine |
|---|---|
| PubChem CID | 88582342 |
| Molecular Formula | C25H54N2 |
| Molecular Weight | 382.72 g/mol |
| Exact Mass | 382.43 |
| IUPAC Name | 4,4,8,12,16,16-hexamethylnonadecane-2,18-diamine |
| SMILES | CC(N)CC(C)(C)CCCC(C)CCCC(C)CCCC(C)(C)CC(C)N |
| InChI | InChI=1S/C25H54N2/c1-20(14-10-16-24(5,6)18-22(3)26)12-9-13-21(2)15-11-17-25(7,8)19-23(4)27/h20-23H,9-19,26-27H2,1-8H3 |
| InChIKey | AEVDOBRRYFWTOA-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.72 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |