C13H17F6NO7S2 — CID 88582349
1,1,2,2,3,3-hexafluoro-3-[4-[3-(hydroxymethyl)-2-oxobut-3-enyl]piperidin-1-yl]sulfonylpropane-1-sulfonic acid (PubChem CID 88582349) has the molecular formula C13H17F6NO7S2 and a molecular weight of 477.40 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-3-[4-[3-(hydroxymethyl)-2-oxobut-3-enyl]piperidin-1-yl]sulfonylpropane-1-sulfonic acid.
| Compound Name | 1,1,2,2,3,3-hexafluoro-3-[4-[3-(hydroxymethyl)-2-oxobut-3-enyl]piperidin-1-yl]sulfonylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 88582349 |
| Molecular Formula | C13H17F6NO7S2 |
| Molecular Weight | 477.40 g/mol |
| Exact Mass | 477.04 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-3-[4-[3-(hydroxymethyl)-2-oxobut-3-enyl]piperidin-1-yl]sulfonylpropane-1-sulfonic acid |
| SMILES | C=C(CO)C(=O)CC1CCN(S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)CC1 |
| InChI | InChI=1S/C13H17F6NO7S2/c1-8(7-21)10(22)6-9-2-4-20(5-3-9)28(23,24)12(16,17)11(14,15)13(18,19)29(25,26)27/h9,21H,1-7H2,(H,25,26,27) |
| InChIKey | DHHPHYYZUCPMGO-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.40 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|