C13H17F6NO5S2 — CID 88582532
3-(2-adamantylsulfamoyl)-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid (PubChem CID 88582532) has the molecular formula C13H17F6NO5S2 and a molecular weight of 445.40 g/mol. Its IUPAC name is 3-(2-adamantylsulfamoyl)-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid.
| Compound Name | 3-(2-adamantylsulfamoyl)-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 88582532 |
| Molecular Formula | C13H17F6NO5S2 |
| Molecular Weight | 445.40 g/mol |
| Exact Mass | 445.05 |
| IUPAC Name | 3-(2-adamantylsulfamoyl)-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)NC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C13H17F6NO5S2/c14-11(15,13(18,19)27(23,24)25)12(16,17)26(21,22)20-10-8-2-6-1-7(4-8)5-9(10)3-6/h6-10,20H,1-5H2,(H,23,24,25) |
| InChIKey | JHUCRLKJTSNADJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|