C13H18O3 — CID 88582787
trans-(1R,2R)-2-cyclohexa-2,4-dien-1-yl-2-(methoxymethoxymethyl)cyclopropane-1-carbaldehyde (PubChem CID 88582787) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is trans-(1R,2R)-2-cyclohexa-2,4-dien-1-yl-2-(methoxymethoxymethyl)cyclopropane-1-carbaldehyde.
| Compound Name | trans-(1R,2R)-2-cyclohexa-2,4-dien-1-yl-2-(methoxymethoxymethyl)cyclopropane-1-carbaldehyde |
|---|---|
| PubChem CID | 88582787 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | trans-(1R,2R)-2-cyclohexa-2,4-dien-1-yl-2-(methoxymethoxymethyl)cyclopropane-1-carbaldehyde |
| SMILES | COCOC[C@@]1(C2C=CC=CC2)C[C@H]1C=O |
| InChI | InChI=1S/C13H18O3/c1-15-10-16-9-13(7-12(13)8-14)11-5-3-2-4-6-11/h2-5,8,11-12H,6-7,9-10H2,1H3/t11?,12-,13+/m0/s1 |
| InChIKey | AJOWVODYPQRDIR-LWNNLKQOSA-N |
| XLogP | 1.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|