About [4-[(3E)-hexa-3,5-dien-3-yl]-4-methoxypiperidin-1-yl]methanamine
[4-[(3E)-hexa-3,5-dien-3-yl]-4-methoxypiperidin-1-yl]methanamine (PubChem CID 88582833) has the molecular formula C13H24N2O
and a molecular weight of 224.35 g/mol. Its IUPAC name is [4-[(3E)-hexa-3,5-dien-3-yl]-4-methoxypiperidin-1-yl]methanamine.
Molecular Properties
| Compound Name | [4-[(3E)-hexa-3,5-dien-3-yl]-4-methoxypiperidin-1-yl]methanamine |
| PubChem CID | 88582833 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | [4-[(3E)-hexa-3,5-dien-3-yl]-4-methoxypiperidin-1-yl]methanamine |
| SMILES | C=C/C=C(\CC)C1(OC)CCN(CN)CC1 |
| InChI | InChI=1S/C13H24N2O/c1-4-6-12(5-2)13(16-3)7-9-15(11-14)10-8-13/h4,6H,1,5,7-11,14H2,2-3H3/b12-6+ |
| InChIKey | MLOIIKNJRMNYDF-WUXMJOGZSA-N |
| XLogP | 1.91 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [4-[(3E)-hexa-3,5-dien-3-yl]-4-methoxypiperidin-1-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(3E)-hexa-3,5-dien-3-yl]-4-methoxypiperidin-1-yl]methanamine?
The IUPAC name of [4-[(3E)-hexa-3,5-dien-3-yl]-4-methoxypiperidin-1-yl]methanamine (CID 88582833) is [4-[(3E)-hexa-3,5-dien-3-yl]-4-methoxypiperidin-1-yl]methanamine.
What is the SMILES notation for [4-[(3E)-hexa-3,5-dien-3-yl]-4-methoxypiperidin-1-yl]methanamine?
The canonical SMILES for [4-[(3E)-hexa-3,5-dien-3-yl]-4-methoxypiperidin-1-yl]methanamine is C=C/C=C(\CC)C1(OC)CCN(CN)CC1.
What is the InChIKey of [4-[(3E)-hexa-3,5-dien-3-yl]-4-methoxypiperidin-1-yl]methanamine?
The InChIKey is MLOIIKNJRMNYDF-WUXMJOGZSA-N. The full InChI is InChI=1S/C13H24N2O/c1-4-6-12(5-2)13(16-3)7-9-15(11-14)10-8-13/h4,6H,1,5,7-11,14H2,2-3H3/b12-6+.
What are the key properties of [4-[(3E)-hexa-3,5-dien-3-yl]-4-methoxypiperidin-1-yl]methanamine?
[4-[(3E)-hexa-3,5-dien-3-yl]-4-methoxypiperidin-1-yl]methanamine has a molecular weight of 224.35 g/mol, XLogP of 1.91, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(3E)-hexa-3,5-dien-3-yl]-4-methoxypiperidin-1-yl]methanamine is sourced from PubChem (CID 88582833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).