C12H19FN2 — CID 88582935
4-[(3E,5E)-6-fluorohepta-1,3,5-trien-3-yl]piperidin-4-amine (PubChem CID 88582935) has the molecular formula C12H19FN2 and a molecular weight of 210.30 g/mol. Its IUPAC name is 4-[(3E,5E)-6-fluorohepta-1,3,5-trien-3-yl]piperidin-4-amine.
| Compound Name | 4-[(3E,5E)-6-fluorohepta-1,3,5-trien-3-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 88582935 |
| Molecular Formula | C12H19FN2 |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 4-[(3E,5E)-6-fluorohepta-1,3,5-trien-3-yl]piperidin-4-amine |
| SMILES | C=C/C(=C\C=C(/C)F)C1(N)CCNCC1 |
| InChI | InChI=1S/C12H19FN2/c1-3-11(5-4-10(2)13)12(14)6-8-15-9-7-12/h3-5,15H,1,6-9,14H2,2H3/b10-4+,11-5+ |
| InChIKey | UTENEZPVZOBHEI-ZVSIBQGLSA-N |
| XLogP | 2.05 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|