About octyl 2-methylsulfonylacetate
octyl 2-methylsulfonylacetate (PubChem CID 88582937) has the molecular formula C11H22O4S
and a molecular weight of 250.36 g/mol. Its IUPAC name is octyl 2-methylsulfonylacetate.
Molecular Properties
| Compound Name | octyl 2-methylsulfonylacetate |
| PubChem CID | 88582937 |
| Molecular Formula | C11H22O4S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | octyl 2-methylsulfonylacetate |
| SMILES | CCCCCCCCOC(=O)CS(C)(=O)=O |
| InChI | InChI=1S/C11H22O4S/c1-3-4-5-6-7-8-9-15-11(12)10-16(2,13)14/h3-10H2,1-2H3 |
| InChIKey | BKNIMFPHFXFCKR-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octyl 2-methylsulfonylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octyl 2-methylsulfonylacetate?
The IUPAC name of octyl 2-methylsulfonylacetate (CID 88582937) is octyl 2-methylsulfonylacetate.
What is the SMILES notation for octyl 2-methylsulfonylacetate?
The canonical SMILES for octyl 2-methylsulfonylacetate is CCCCCCCCOC(=O)CS(C)(=O)=O.
What is the InChIKey of octyl 2-methylsulfonylacetate?
The InChIKey is BKNIMFPHFXFCKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O4S/c1-3-4-5-6-7-8-9-15-11(12)10-16(2,13)14/h3-10H2,1-2H3.
What are the key properties of octyl 2-methylsulfonylacetate?
octyl 2-methylsulfonylacetate has a molecular weight of 250.36 g/mol, XLogP of 1.93, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for octyl 2-methylsulfonylacetate is sourced from PubChem (CID 88582937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).