C28H18F4N2O3 — CID 88582992
6-methyl-2-[2,3,5,6-tetrafluoro-4-(2-phenylmethoxyphenyl)phenyl]-1H-benzimidazole-4-carboxylic acid (PubChem CID 88582992) has the molecular formula C28H18F4N2O3 and a molecular weight of 506.46 g/mol. Its IUPAC name is 6-methyl-2-[2,3,5,6-tetrafluoro-4-(2-phenylmethoxyphenyl)phenyl]-1H-benzimidazole-4-carboxylic acid.
| Compound Name | 6-methyl-2-[2,3,5,6-tetrafluoro-4-(2-phenylmethoxyphenyl)phenyl]-1H-benzimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 88582992 |
| Molecular Formula | C28H18F4N2O3 |
| Molecular Weight | 506.46 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | 6-methyl-2-[2,3,5,6-tetrafluoro-4-(2-phenylmethoxyphenyl)phenyl]-1H-benzimidazole-4-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)c2nc(-c3c(F)c(F)c(-c4ccccc4OCc4ccccc4)c(F)c3F)[nH]c2c1 |
| InChI | InChI=1S/C28H18F4N2O3/c1-14-11-17(28(35)36)26-18(12-14)33-27(34-26)21-24(31)22(29)20(23(30)25(21)32)16-9-5-6-10-19(16)37-13-15-7-3-2-4-8-15/h2-12H,13H2,1H3,(H,33,34)(H,35,36) |
| InChIKey | BBTZKEVGRYBKFG-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.46 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|