C27H16F4N2O3 — CID 88583000
2-[2,3,5,6-tetrafluoro-4-(3-phenylmethoxyphenyl)phenyl]-1H-benzimidazole-4-carboxylic acid (PubChem CID 88583000) has the molecular formula C27H16F4N2O3 and a molecular weight of 492.43 g/mol. Its IUPAC name is 2-[2,3,5,6-tetrafluoro-4-(3-phenylmethoxyphenyl)phenyl]-1H-benzimidazole-4-carboxylic acid.
| Compound Name | 2-[2,3,5,6-tetrafluoro-4-(3-phenylmethoxyphenyl)phenyl]-1H-benzimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 88583000 |
| Molecular Formula | C27H16F4N2O3 |
| Molecular Weight | 492.43 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | 2-[2,3,5,6-tetrafluoro-4-(3-phenylmethoxyphenyl)phenyl]-1H-benzimidazole-4-carboxylic acid |
| SMILES | O=C(O)c1cccc2[nH]c(-c3c(F)c(F)c(-c4cccc(OCc5ccccc5)c4)c(F)c3F)nc12 |
| InChI | InChI=1S/C27H16F4N2O3/c28-21-19(15-8-4-9-16(12-15)36-13-14-6-2-1-3-7-14)22(29)24(31)20(23(21)30)26-32-18-11-5-10-17(27(34)35)25(18)33-26/h1-12H,13H2,(H,32,33)(H,34,35) |
| InChIKey | HZUTZWRSWDXABT-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.43 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|