C18H8F4N2O2S — CID 88583057
2-(2,3,5,6-tetrafluoro-4-thiophen-2-ylphenyl)-1H-benzimidazole-4-carboxylic acid (PubChem CID 88583057) has the molecular formula C18H8F4N2O2S and a molecular weight of 392.33 g/mol. Its IUPAC name is 2-(2,3,5,6-tetrafluoro-4-thiophen-2-ylphenyl)-1H-benzimidazole-4-carboxylic acid.
| Compound Name | 2-(2,3,5,6-tetrafluoro-4-thiophen-2-ylphenyl)-1H-benzimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 88583057 |
| Molecular Formula | C18H8F4N2O2S |
| Molecular Weight | 392.33 g/mol |
| Exact Mass | 392.02 |
| IUPAC Name | 2-(2,3,5,6-tetrafluoro-4-thiophen-2-ylphenyl)-1H-benzimidazole-4-carboxylic acid |
| SMILES | O=C(O)c1cccc2[nH]c(-c3c(F)c(F)c(-c4cccs4)c(F)c3F)nc12 |
| InChI | InChI=1S/C18H8F4N2O2S/c19-12-10(9-5-2-6-27-9)13(20)15(22)11(14(12)21)17-23-8-4-1-3-7(18(25)26)16(8)24-17/h1-6H,(H,23,24)(H,25,26) |
| InChIKey | HXAHPIFOQVKSSZ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.33 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|