About CID 88583138
CID 88583138 (PubChem CID 88583138) has the molecular formula C30H18BBrN2
and a molecular weight of 497.20 g/mol.
Molecular Properties
| Compound Name | CID 88583138 |
| PubChem CID | 88583138 |
| Molecular Formula | C30H18BBrN2 |
| Molecular Weight | 497.20 g/mol |
| Exact Mass | 496.07 |
| IUPAC Name | — |
| SMILES | [B]c1cc(Br)cc(-c2nc(-c3ccc4ccccc4c3)cc(-c3ccc4ccccc4c3)n2)c1 |
| InChI | InChI=1S/C30H18BBrN2/c31-26-15-25(16-27(32)17-26)30-33-28(23-11-9-19-5-1-3-7-21(19)13-23)18-29(34-30)24-12-10-20-6-2-4-8-22(20)14-24/h1-18H |
| InChIKey | HNMWJFPGNGHBFJ-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 497.20 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 88583138 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88583138?
The IUPAC name of CID 88583138 (CID 88583138) is not available.
What is the SMILES notation for CID 88583138?
The canonical SMILES for CID 88583138 is [B]c1cc(Br)cc(-c2nc(-c3ccc4ccccc4c3)cc(-c3ccc4ccccc4c3)n2)c1.
What is the InChIKey of CID 88583138?
The InChIKey is HNMWJFPGNGHBFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H18BBrN2/c31-26-15-25(16-27(32)17-26)30-33-28(23-11-9-19-5-1-3-7-21(19)13-23)18-29(34-30)24-12-10-20-6-2-4-8-22(20)14-24/h1-18H.
What are the key properties of CID 88583138?
CID 88583138 has a molecular weight of 497.20 g/mol, XLogP of 7.34, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88583138 is sourced from PubChem (CID 88583138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).