C31H27N5O5 — CID 88583195
N-[4-[[6-[3-[(E)-2-cyanoethenyl]-5-methylphenoxy]-2,4-dioxo-5-propan-2-ylpyrimidin-1-yl]methyl]-2-pyridinyl]-2-formylbenzamide (PubChem CID 88583195) has the molecular formula C31H27N5O5 and a molecular weight of 549.59 g/mol. Its IUPAC name is N-[4-[[6-[3-[(E)-2-cyanoethenyl]-5-methylphenoxy]-2,4-dioxo-5-propan-2-ylpyrimidin-1-yl]methyl]-2-pyridinyl]-2-formylbenzamide.
| Compound Name | N-[4-[[6-[3-[(E)-2-cyanoethenyl]-5-methylphenoxy]-2,4-dioxo-5-propan-2-ylpyrimidin-1-yl]methyl]-2-pyridinyl]-2-formylbenzamide |
|---|---|
| PubChem CID | 88583195 |
| Molecular Formula | C31H27N5O5 |
| Molecular Weight | 549.59 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | N-[4-[[6-[3-[(E)-2-cyanoethenyl]-5-methylphenoxy]-2,4-dioxo-5-propan-2-ylpyrimidin-1-yl]methyl]-2-pyridinyl]-2-formylbenzamide |
| SMILES | Cc1cc(/C=C/C#N)cc(Oc2c(C(C)C)c(=O)[nH]c(=O)n2Cc2ccnc(NC(=O)c3ccccc3C=O)c2)c1 |
| InChI | InChI=1S/C31H27N5O5/c1-19(2)27-29(39)35-31(40)36(30(27)41-24-14-20(3)13-21(15-24)7-6-11-32)17-22-10-12-33-26(16-22)34-28(38)25-9-5-4-8-23(25)18-37/h4-10,12-16,18-19H,17H2,1-3H3,(H,33,34,38)(H,35,39,40)/b7-6+ |
| InChIKey | WOJKBXDDIOJLBR-VOTSOKGWSA-N |
| XLogP | 4.81 |
| TPSA | 146.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.59 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|