C22H22F2N2O3 — CID 88583224
2,6-difluoro-N-[1'-(3-oxopropyl)spiro[2H-1-benzofuran-3,4'-piperidine]-6-yl]benzamide (PubChem CID 88583224) has the molecular formula C22H22F2N2O3 and a molecular weight of 400.43 g/mol. Its IUPAC name is 2,6-difluoro-N-[1'-(3-oxopropyl)spiro[2H-1-benzofuran-3,4'-piperidine]-6-yl]benzamide.
| Compound Name | 2,6-difluoro-N-[1'-(3-oxopropyl)spiro[2H-1-benzofuran-3,4'-piperidine]-6-yl]benzamide |
|---|---|
| PubChem CID | 88583224 |
| Molecular Formula | C22H22F2N2O3 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 2,6-difluoro-N-[1'-(3-oxopropyl)spiro[2H-1-benzofuran-3,4'-piperidine]-6-yl]benzamide |
| SMILES | O=CCCN1CCC2(CC1)COc1cc(NC(=O)c3c(F)cccc3F)ccc12 |
| InChI | InChI=1S/C22H22F2N2O3/c23-17-3-1-4-18(24)20(17)21(28)25-15-5-6-16-19(13-15)29-14-22(16)7-10-26(11-8-22)9-2-12-27/h1,3-6,12-13H,2,7-11,14H2,(H,25,28) |
| InChIKey | JMYYXUCOBLOOBZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|