C8H11F4NO4 — CID 88583412
2,2,3,3-tetrafluoro-N,N-bis(2-hydroxyethyl)-4-oxobutanamide (PubChem CID 88583412) has the molecular formula C8H11F4NO4 and a molecular weight of 261.17 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N,N-bis(2-hydroxyethyl)-4-oxobutanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N,N-bis(2-hydroxyethyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 88583412 |
| Molecular Formula | C8H11F4NO4 |
| Molecular Weight | 261.17 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N,N-bis(2-hydroxyethyl)-4-oxobutanamide |
| SMILES | O=CC(F)(F)C(F)(F)C(=O)N(CCO)CCO |
| InChI | InChI=1S/C8H11F4NO4/c9-7(10,5-16)8(11,12)6(17)13(1-3-14)2-4-15/h5,14-15H,1-4H2 |
| InChIKey | BWEAKYMCCJCJFB-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.17 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|