C18H20F5N3O2 — CID 88583420
8-tert-butyl-4-methyl-6-(2,2,3,3,3-pentafluoropropoxy)quinoline-2-carbohydrazide (PubChem CID 88583420) has the molecular formula C18H20F5N3O2 and a molecular weight of 405.37 g/mol. Its IUPAC name is 8-tert-butyl-4-methyl-6-(2,2,3,3,3-pentafluoropropoxy)quinoline-2-carbohydrazide.
| Compound Name | 8-tert-butyl-4-methyl-6-(2,2,3,3,3-pentafluoropropoxy)quinoline-2-carbohydrazide |
|---|---|
| PubChem CID | 88583420 |
| Molecular Formula | C18H20F5N3O2 |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 8-tert-butyl-4-methyl-6-(2,2,3,3,3-pentafluoropropoxy)quinoline-2-carbohydrazide |
| SMILES | Cc1cc(C(=O)NN)nc2c(C(C)(C)C)cc(OCC(F)(F)C(F)(F)F)cc12 |
| InChI | InChI=1S/C18H20F5N3O2/c1-9-5-13(15(27)26-24)25-14-11(9)6-10(7-12(14)16(2,3)4)28-8-17(19,20)18(21,22)23/h5-7H,8,24H2,1-4H3,(H,26,27) |
| InChIKey | ODKXEVYECXRFGC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|