C19H21NO2S2 — CID 88583471
(12'R)-12'-methylspiro[1,3-dithiane-2,16'-13-oxa-10-azatetracyclo[8.7.0.02,7.011,15]heptadeca-2,4,6,11(15)-tetraene]-14'-one (PubChem CID 88583471) has the molecular formula C19H21NO2S2 and a molecular weight of 359.52 g/mol. Its IUPAC name is (12'R)-12'-methylspiro[1,3-dithiane-2,16'-13-oxa-10-azatetracyclo[8.7.0.02,7.011,15]heptadeca-2,4,6,11(15)-tetraene]-14'-one.
| Compound Name | (12'R)-12'-methylspiro[1,3-dithiane-2,16'-13-oxa-10-azatetracyclo[8.7.0.02,7.011,15]heptadeca-2,4,6,11(15)-tetraene]-14'-one |
|---|---|
| PubChem CID | 88583471 |
| Molecular Formula | C19H21NO2S2 |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | (12'R)-12'-methylspiro[1,3-dithiane-2,16'-13-oxa-10-azatetracyclo[8.7.0.02,7.011,15]heptadeca-2,4,6,11(15)-tetraene]-14'-one |
| SMILES | C[C@H]1OC(=O)C2=C1N1CCc3ccccc3C1CC21SCCCS1 |
| InChI | InChI=1S/C19H21NO2S2/c1-12-17-16(18(21)22-12)19(23-9-4-10-24-19)11-15-14-6-3-2-5-13(14)7-8-20(15)17/h2-3,5-6,12,15H,4,7-11H2,1H3/t12-,15?/m1/s1 |
| InChIKey | AJJNMGOSSWWTSN-KEKZHRQWSA-N |
| XLogP | 3.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |