About 1,3-bis[[(E)-(2-methyl-6,7-dihydro-5H-quinolin-8-ylidene)amino]oxy]propan-2-ol
1,3-bis[[(E)-(2-methyl-6,7-dihydro-5H-quinolin-8-ylidene)amino]oxy]propan-2-ol (PubChem CID 88583506) has the molecular formula C23H28N4O3
and a molecular weight of 408.50 g/mol. Its IUPAC name is 1,3-bis[[(E)-(2-methyl-6,7-dihydro-5H-quinolin-8-ylidene)amino]oxy]propan-2-ol.
Molecular Properties
| Compound Name | 1,3-bis[[(E)-(2-methyl-6,7-dihydro-5H-quinolin-8-ylidene)amino]oxy]propan-2-ol |
| PubChem CID | 88583506 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 1,3-bis[[(E)-(2-methyl-6,7-dihydro-5H-quinolin-8-ylidene)amino]oxy]propan-2-ol |
| SMILES | Cc1ccc2c(n1)/C(=N/OCC(O)CO/N=C1\CCCc3ccc(C)nc31)CCC2 |
| InChI | InChI=1S/C23H28N4O3/c1-15-9-11-17-5-3-7-20(22(17)24-15)26-29-13-19(28)14-30-27-21-8-4-6-18-12-10-16(2)25-23(18)21/h9-12,19,28H,3-8,13-14H2,1-2H3/b26-20+,27-21+ |
| InChIKey | UCPQFYFCPLNTPA-CRYYDKFDSA-N |
| XLogP | 3.27 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis[[(E)-(2-methyl-6,7-dihydro-5H-quinolin-8-ylidene)amino]oxy]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis[[(E)-(2-methyl-6,7-dihydro-5H-quinolin-8-ylidene)amino]oxy]propan-2-ol?
The IUPAC name of 1,3-bis[[(E)-(2-methyl-6,7-dihydro-5H-quinolin-8-ylidene)amino]oxy]propan-2-ol (CID 88583506) is 1,3-bis[[(E)-(2-methyl-6,7-dihydro-5H-quinolin-8-ylidene)amino]oxy]propan-2-ol.
What is the SMILES notation for 1,3-bis[[(E)-(2-methyl-6,7-dihydro-5H-quinolin-8-ylidene)amino]oxy]propan-2-ol?
The canonical SMILES for 1,3-bis[[(E)-(2-methyl-6,7-dihydro-5H-quinolin-8-ylidene)amino]oxy]propan-2-ol is Cc1ccc2c(n1)/C(=N/OCC(O)CO/N=C1\CCCc3ccc(C)nc31)CCC2.
What is the InChIKey of 1,3-bis[[(E)-(2-methyl-6,7-dihydro-5H-quinolin-8-ylidene)amino]oxy]propan-2-ol?
The InChIKey is UCPQFYFCPLNTPA-CRYYDKFDSA-N. The full InChI is InChI=1S/C23H28N4O3/c1-15-9-11-17-5-3-7-20(22(17)24-15)26-29-13-19(28)14-30-27-21-8-4-6-18-12-10-16(2)25-23(18)21/h9-12,19,28H,3-8,13-14H2,1-2H3/b26-20+,27-21+.
What are the key properties of 1,3-bis[[(E)-(2-methyl-6,7-dihydro-5H-quinolin-8-ylidene)amino]oxy]propan-2-ol?
1,3-bis[[(E)-(2-methyl-6,7-dihydro-5H-quinolin-8-ylidene)amino]oxy]propan-2-ol has a molecular weight of 408.50 g/mol, XLogP of 3.27, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis[[(E)-(2-methyl-6,7-dihydro-5H-quinolin-8-ylidene)amino]oxy]propan-2-ol is sourced from PubChem (CID 88583506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).