C19H18N4O2S2 — CID 88583971
N-[3-[4-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]-1H-pyrazol-5-yl]phenyl]thiophene-2-sulfonamide (PubChem CID 88583971) has the molecular formula C19H18N4O2S2 and a molecular weight of 398.51 g/mol. Its IUPAC name is N-[3-[4-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]-1H-pyrazol-5-yl]phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[3-[4-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]-1H-pyrazol-5-yl]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 88583971 |
| Molecular Formula | C19H18N4O2S2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | N-[3-[4-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]-1H-pyrazol-5-yl]phenyl]thiophene-2-sulfonamide |
| SMILES | C=C/C=C(\C=C/N)c1cn[nH]c1-c1cccc(NS(=O)(=O)c2cccs2)c1 |
| InChI | InChI=1S/C19H18N4O2S2/c1-2-5-14(9-10-20)17-13-21-22-19(17)15-6-3-7-16(12-15)23-27(24,25)18-8-4-11-26-18/h2-13,23H,1,20H2,(H,21,22)/b10-9-,14-5+ |
| InChIKey | YLRDPHOIKGFELG-DVBADTPPSA-N |
| XLogP | 3.98 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|