C14H19NO2S — CID 88584076
N-[3-methyl-4-[(2E)-3-methylpenta-2,4-dien-2-yl]phenyl]methanesulfonamide (PubChem CID 88584076) has the molecular formula C14H19NO2S and a molecular weight of 265.38 g/mol. Its IUPAC name is N-[3-methyl-4-[(2E)-3-methylpenta-2,4-dien-2-yl]phenyl]methanesulfonamide.
| Compound Name | N-[3-methyl-4-[(2E)-3-methylpenta-2,4-dien-2-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 88584076 |
| Molecular Formula | C14H19NO2S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | N-[3-methyl-4-[(2E)-3-methylpenta-2,4-dien-2-yl]phenyl]methanesulfonamide |
| SMILES | C=C/C(C)=C(\C)c1ccc(NS(C)(=O)=O)cc1C |
| InChI | InChI=1S/C14H19NO2S/c1-6-10(2)12(4)14-8-7-13(9-11(14)3)15-18(5,16)17/h6-9,15H,1H2,2-5H3/b12-10+ |
| InChIKey | LHRYUQMRFOETHL-ZRDIBKRKSA-N |
| XLogP | 3.35 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|