C21H22F6N4O3 — CID 88584079
(E)-N-methoxy-1-[6-[3-[(E)-1-[6-(2,2,2-trifluoroethoxy)-4-(trifluoromethyl)-2-pyridinyl]ethylideneamino]oxypropyl]-2-pyridinyl]ethanimine (PubChem CID 88584079) has the molecular formula C21H22F6N4O3 and a molecular weight of 492.42 g/mol. Its IUPAC name is (E)-N-methoxy-1-[6-[3-[(E)-1-[6-(2,2,2-trifluoroethoxy)-4-(trifluoromethyl)-2-pyridinyl]ethylideneamino]oxypropyl]-2-pyridinyl]ethanimine.
| Compound Name | (E)-N-methoxy-1-[6-[3-[(E)-1-[6-(2,2,2-trifluoroethoxy)-4-(trifluoromethyl)-2-pyridinyl]ethylideneamino]oxypropyl]-2-pyridinyl]ethanimine |
|---|---|
| PubChem CID | 88584079 |
| Molecular Formula | C21H22F6N4O3 |
| Molecular Weight | 492.42 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | (E)-N-methoxy-1-[6-[3-[(E)-1-[6-(2,2,2-trifluoroethoxy)-4-(trifluoromethyl)-2-pyridinyl]ethylideneamino]oxypropyl]-2-pyridinyl]ethanimine |
| SMILES | CO/N=C(\C)c1cccc(CCCO/N=C(\C)c2cc(C(F)(F)F)cc(OCC(F)(F)F)n2)n1 |
| InChI | InChI=1S/C21H22F6N4O3/c1-13(30-32-3)17-8-4-6-16(28-17)7-5-9-34-31-14(2)18-10-15(21(25,26)27)11-19(29-18)33-12-20(22,23)24/h4,6,8,10-11H,5,7,9,12H2,1-3H3/b30-13+,31-14+ |
| InChIKey | KKLFBCAFJSESAC-HNZHSOEWSA-N |
| XLogP | 5.18 |
| TPSA | 78.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.42 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|