C22H35F3O7S — CID 88584409
[(3aS,5aS,6S,7S,9aR,9bS)-3a,6-dimethyl-6,7-bis(2-methylperoxyethyl)-4,5,5a,7,8,9,9a,9b-octahydro-1H-cyclopenta[a]naphthalen-3-yl] trifluoromethanesulfonate (PubChem CID 88584409) has the molecular formula C22H35F3O7S and a molecular weight of 500.58 g/mol. Its IUPAC name is [(3aS,5aS,6S,7S,9aR,9bS)-3a,6-dimethyl-6,7-bis(2-methylperoxyethyl)-4,5,5a,7,8,9,9a,9b-octahydro-1H-cyclopenta[a]naphthalen-3-yl] trifluoromethanesulfonate.
| Compound Name | [(3aS,5aS,6S,7S,9aR,9bS)-3a,6-dimethyl-6,7-bis(2-methylperoxyethyl)-4,5,5a,7,8,9,9a,9b-octahydro-1H-cyclopenta[a]naphthalen-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 88584409 |
| Molecular Formula | C22H35F3O7S |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | [(3aS,5aS,6S,7S,9aR,9bS)-3a,6-dimethyl-6,7-bis(2-methylperoxyethyl)-4,5,5a,7,8,9,9a,9b-octahydro-1H-cyclopenta[a]naphthalen-3-yl] trifluoromethanesulfonate |
| SMILES | COOCC[C@@H]1CC[C@@H]2[C@H](CC[C@]3(C)C(OS(=O)(=O)C(F)(F)F)=CC[C@@H]23)[C@@]1(C)CCOOC |
| InChI | InChI=1S/C22H35F3O7S/c1-20(12-14-31-29-4)15(10-13-30-28-3)5-6-16-17-7-8-19(21(17,2)11-9-18(16)20)32-33(26,27)22(23,24)25/h8,15-18H,5-7,9-14H2,1-4H3/t15-,16-,17-,18-,20-,21-/m0/s1 |
| InChIKey | ZFNLNOYOFGKPLO-ZKHIMWLXSA-N |
| XLogP | 5.14 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|