About CID 88585334
CID 88585334 (PubChem CID 88585334) has the molecular formula C20H27BN4O3
and a molecular weight of 382.27 g/mol.
Molecular Properties
| Compound Name | CID 88585334 |
| PubChem CID | 88585334 |
| Molecular Formula | C20H27BN4O3 |
| Molecular Weight | 382.27 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(C2CN=C([C@@H]3CCCN3C(=O)[C@@H](NC(=O)OC)C(C)C)N2)cc1 |
| InChI | InChI=1S/C20H27BN4O3/c1-12(2)17(24-20(27)28-3)19(26)25-10-4-5-16(25)18-22-11-15(23-18)13-6-8-14(21)9-7-13/h6-9,12,15-17H,4-5,10-11H2,1-3H3,(H,22,23)(H,24,27)/t15?,16-,17-/m0/s1 |
| InChIKey | BPXFKCATABHCKG-BSOSBYQFSA-N |
| XLogP | 0.89 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.27 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 88585334 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88585334?
The IUPAC name of CID 88585334 (CID 88585334) is not available.
What is the SMILES notation for CID 88585334?
The canonical SMILES for CID 88585334 is [B]c1ccc(C2CN=C([C@@H]3CCCN3C(=O)[C@@H](NC(=O)OC)C(C)C)N2)cc1.
What is the InChIKey of CID 88585334?
The InChIKey is BPXFKCATABHCKG-BSOSBYQFSA-N. The full InChI is InChI=1S/C20H27BN4O3/c1-12(2)17(24-20(27)28-3)19(26)25-10-4-5-16(25)18-22-11-15(23-18)13-6-8-14(21)9-7-13/h6-9,12,15-17H,4-5,10-11H2,1-3H3,(H,22,23)(H,24,27)/t15?,16-,17-/m0/s1.
What are the key properties of CID 88585334?
CID 88585334 has a molecular weight of 382.27 g/mol, XLogP of 0.89, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88585334 is sourced from PubChem (CID 88585334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).