C18H17ClN4O2S — CID 8858539
1-[3-[[1-(3-chlorophenyl)tetrazol-5-yl]sulfanylmethyl]-4-ethoxyphenyl]ethanone (PubChem CID 8858539) has the molecular formula C18H17ClN4O2S and a molecular weight of 388.88 g/mol. Its IUPAC name is 1-[3-[[1-(3-chlorophenyl)tetrazol-5-yl]sulfanylmethyl]-4-ethoxyphenyl]ethanone.
| Compound Name | 1-[3-[[1-(3-chlorophenyl)tetrazol-5-yl]sulfanylmethyl]-4-ethoxyphenyl]ethanone |
|---|---|
| PubChem CID | 8858539 |
| Molecular Formula | C18H17ClN4O2S |
| Molecular Weight | 388.88 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 1-[3-[[1-(3-chlorophenyl)tetrazol-5-yl]sulfanylmethyl]-4-ethoxyphenyl]ethanone |
| SMILES | CCOc1ccc(C(C)=O)cc1CSc1nnnn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H17ClN4O2S/c1-3-25-17-8-7-13(12(2)24)9-14(17)11-26-18-20-21-22-23(18)16-6-4-5-15(19)10-16/h4-10H,3,11H2,1-2H3 |
| InChIKey | KVQDBZBIKRKVCI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.88 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |