About 4-[(3E)-hexa-1,3-dien-3-yl]-1-methylpiperidine
4-[(3E)-hexa-1,3-dien-3-yl]-1-methylpiperidine (PubChem CID 88585405) has the molecular formula C12H21N
and a molecular weight of 179.31 g/mol. Its IUPAC name is 4-[(3E)-hexa-1,3-dien-3-yl]-1-methylpiperidine.
Molecular Properties
| Compound Name | 4-[(3E)-hexa-1,3-dien-3-yl]-1-methylpiperidine |
| PubChem CID | 88585405 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 4-[(3E)-hexa-1,3-dien-3-yl]-1-methylpiperidine |
| SMILES | C=C/C(=C\CC)C1CCN(C)CC1 |
| InChI | InChI=1S/C12H21N/c1-4-6-11(5-2)12-7-9-13(3)10-8-12/h5-6,12H,2,4,7-10H2,1,3H3/b11-6+ |
| InChIKey | ZXNZMGNOPKUSFW-IZZDOVSWSA-N |
| XLogP | 2.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3E)-hexa-1,3-dien-3-yl]-1-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3E)-hexa-1,3-dien-3-yl]-1-methylpiperidine?
The IUPAC name of 4-[(3E)-hexa-1,3-dien-3-yl]-1-methylpiperidine (CID 88585405) is 4-[(3E)-hexa-1,3-dien-3-yl]-1-methylpiperidine.
What is the SMILES notation for 4-[(3E)-hexa-1,3-dien-3-yl]-1-methylpiperidine?
The canonical SMILES for 4-[(3E)-hexa-1,3-dien-3-yl]-1-methylpiperidine is C=C/C(=C\CC)C1CCN(C)CC1.
What is the InChIKey of 4-[(3E)-hexa-1,3-dien-3-yl]-1-methylpiperidine?
The InChIKey is ZXNZMGNOPKUSFW-IZZDOVSWSA-N. The full InChI is InChI=1S/C12H21N/c1-4-6-11(5-2)12-7-9-13(3)10-8-12/h5-6,12H,2,4,7-10H2,1,3H3/b11-6+.
What are the key properties of 4-[(3E)-hexa-1,3-dien-3-yl]-1-methylpiperidine?
4-[(3E)-hexa-1,3-dien-3-yl]-1-methylpiperidine has a molecular weight of 179.31 g/mol, XLogP of 2.85, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3E)-hexa-1,3-dien-3-yl]-1-methylpiperidine is sourced from PubChem (CID 88585405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).