C19H16N4O3S — CID 88585423
N-[(4-methoxyphenyl)-methylidene-oxo-λ6-sulfanyl]-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)pyridin-2-amine (PubChem CID 88585423) has the molecular formula C19H16N4O3S and a molecular weight of 380.43 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)-methylidene-oxo-λ6-sulfanyl]-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)pyridin-2-amine.
| Compound Name | N-[(4-methoxyphenyl)-methylidene-oxo-λ6-sulfanyl]-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 88585423 |
| Molecular Formula | C19H16N4O3S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | N-[(4-methoxyphenyl)-methylidene-oxo-λ6-sulfanyl]-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)pyridin-2-amine |
| SMILES | C=S(=O)(Nc1cc(-c2nc3ncccc3o2)ccn1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H16N4O3S/c1-25-14-5-7-15(8-6-14)27(2,24)23-17-12-13(9-11-20-17)19-22-18-16(26-19)4-3-10-21-18/h3-12H,2H2,1H3,(H,20,23,24) |
| InChIKey | FPCIETSXWROCIL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|