C10H9ClF3IN4 — CID 88585476
6-chloro-3-iodo-N-(3,3,3-trifluoro-2-methylpropyl)imidazo[1,2-b]pyridazin-8-amine (PubChem CID 88585476) has the molecular formula C10H9ClF3IN4 and a molecular weight of 404.56 g/mol. Its IUPAC name is 6-chloro-3-iodo-N-(3,3,3-trifluoro-2-methylpropyl)imidazo[1,2-b]pyridazin-8-amine.
| Compound Name | 6-chloro-3-iodo-N-(3,3,3-trifluoro-2-methylpropyl)imidazo[1,2-b]pyridazin-8-amine |
|---|---|
| PubChem CID | 88585476 |
| Molecular Formula | C10H9ClF3IN4 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 403.95 |
| IUPAC Name | 6-chloro-3-iodo-N-(3,3,3-trifluoro-2-methylpropyl)imidazo[1,2-b]pyridazin-8-amine |
| SMILES | CC(CNc1cc(Cl)nn2c(I)cnc12)C(F)(F)F |
| InChI | InChI=1S/C10H9ClF3IN4/c1-5(10(12,13)14)3-16-6-2-7(11)18-19-8(15)4-17-9(6)19/h2,4-5,16H,3H2,1H3 |
| InChIKey | JZQWFTRLVWPDGC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|