About (4Z,5Z)-4-ethylidene-7-methoxyocta-5,7-dien-2-amine
(4Z,5Z)-4-ethylidene-7-methoxyocta-5,7-dien-2-amine (PubChem CID 88585562) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is (4Z,5Z)-4-ethylidene-7-methoxyocta-5,7-dien-2-amine.
Molecular Properties
| Compound Name | (4Z,5Z)-4-ethylidene-7-methoxyocta-5,7-dien-2-amine |
| PubChem CID | 88585562 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (4Z,5Z)-4-ethylidene-7-methoxyocta-5,7-dien-2-amine |
| SMILES | C=C(/C=C\C(=C/C)CC(C)N)OC |
| InChI | InChI=1S/C11H19NO/c1-5-11(8-9(2)12)7-6-10(3)13-4/h5-7,9H,3,8,12H2,1-2,4H3/b7-6-,11-5+ |
| InChIKey | JCHWNGVTHUECMQ-TUKAJDRUSA-N |
| XLogP | 2.39 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4Z,5Z)-4-ethylidene-7-methoxyocta-5,7-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z,5Z)-4-ethylidene-7-methoxyocta-5,7-dien-2-amine?
The IUPAC name of (4Z,5Z)-4-ethylidene-7-methoxyocta-5,7-dien-2-amine (CID 88585562) is (4Z,5Z)-4-ethylidene-7-methoxyocta-5,7-dien-2-amine.
What is the SMILES notation for (4Z,5Z)-4-ethylidene-7-methoxyocta-5,7-dien-2-amine?
The canonical SMILES for (4Z,5Z)-4-ethylidene-7-methoxyocta-5,7-dien-2-amine is C=C(/C=C\C(=C/C)CC(C)N)OC.
What is the InChIKey of (4Z,5Z)-4-ethylidene-7-methoxyocta-5,7-dien-2-amine?
The InChIKey is JCHWNGVTHUECMQ-TUKAJDRUSA-N. The full InChI is InChI=1S/C11H19NO/c1-5-11(8-9(2)12)7-6-10(3)13-4/h5-7,9H,3,8,12H2,1-2,4H3/b7-6-,11-5+.
What are the key properties of (4Z,5Z)-4-ethylidene-7-methoxyocta-5,7-dien-2-amine?
(4Z,5Z)-4-ethylidene-7-methoxyocta-5,7-dien-2-amine has a molecular weight of 181.28 g/mol, XLogP of 2.39, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z,5Z)-4-ethylidene-7-methoxyocta-5,7-dien-2-amine is sourced from PubChem (CID 88585562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).