C20H30N6O4 — CID 88585637
tert-butyl N-[5-[[2-amino-5-(morpholin-4-ylmethyl)anilino]oxymethyl]-1H-pyrazol-4-yl]carbamate (PubChem CID 88585637) has the molecular formula C20H30N6O4 and a molecular weight of 418.50 g/mol. Its IUPAC name is tert-butyl N-[5-[[2-amino-5-(morpholin-4-ylmethyl)anilino]oxymethyl]-1H-pyrazol-4-yl]carbamate.
| Compound Name | tert-butyl N-[5-[[2-amino-5-(morpholin-4-ylmethyl)anilino]oxymethyl]-1H-pyrazol-4-yl]carbamate |
|---|---|
| PubChem CID | 88585637 |
| Molecular Formula | C20H30N6O4 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | tert-butyl N-[5-[[2-amino-5-(morpholin-4-ylmethyl)anilino]oxymethyl]-1H-pyrazol-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cn[nH]c1CONc1cc(CN2CCOCC2)ccc1N |
| InChI | InChI=1S/C20H30N6O4/c1-20(2,3)30-19(27)23-17-11-22-24-18(17)13-29-25-16-10-14(4-5-15(16)21)12-26-6-8-28-9-7-26/h4-5,10-11,25H,6-9,12-13,21H2,1-3H3,(H,22,24)(H,23,27) |
| InChIKey | TUIGPHVFRXATJE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 126.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|