C13H16F6O2 — CID 88586098
7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-one (PubChem CID 88586098) has the molecular formula C13H16F6O2 and a molecular weight of 318.26 g/mol. Its IUPAC name is 7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-one.
| Compound Name | 7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 88586098 |
| Molecular Formula | C13H16F6O2 |
| Molecular Weight | 318.26 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-one |
| SMILES | O=C1CCC2CCC(C(O)(C(F)(F)F)C(F)(F)F)CC2C1 |
| InChI | InChI=1S/C13H16F6O2/c14-12(15,16)11(21,13(17,18)19)9-3-1-7-2-4-10(20)6-8(7)5-9/h7-9,21H,1-6H2 |
| InChIKey | DUGWTMSYCWEQEQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.26 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |