C27H26F6O8S2 — CID 88586719
3-[4-[1-[1-(6-ethenylnaphthalen-2-yl)oxybutoxy]ethyl]phenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid (PubChem CID 88586719) has the molecular formula C27H26F6O8S2 and a molecular weight of 656.62 g/mol. Its IUPAC name is 3-[4-[1-[1-(6-ethenylnaphthalen-2-yl)oxybutoxy]ethyl]phenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid.
| Compound Name | 3-[4-[1-[1-(6-ethenylnaphthalen-2-yl)oxybutoxy]ethyl]phenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 88586719 |
| Molecular Formula | C27H26F6O8S2 |
| Molecular Weight | 656.62 g/mol |
| Exact Mass | 656.10 |
| IUPAC Name | 3-[4-[1-[1-(6-ethenylnaphthalen-2-yl)oxybutoxy]ethyl]phenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
| SMILES | C=Cc1ccc2cc(OC(CCC)OC(C)c3ccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)cc3)ccc2c1 |
| InChI | InChI=1S/C27H26F6O8S2/c1-4-6-24(40-23-14-11-20-15-18(5-2)7-8-21(20)16-23)39-17(3)19-9-12-22(13-10-19)41-43(37,38)27(32,33)25(28,29)26(30,31)42(34,35)36/h5,7-17,24H,2,4,6H2,1,3H3,(H,34,35,36) |
| InChIKey | BFQNBUZDOOOVSY-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.62 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|