C7H11NO2 — CID 88586817
(1E,3E)-1-amino-5-methylhexa-1,3,5-triene-2,3-diol (PubChem CID 88586817) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is (1E,3E)-1-amino-5-methylhexa-1,3,5-triene-2,3-diol.
| Compound Name | (1E,3E)-1-amino-5-methylhexa-1,3,5-triene-2,3-diol |
|---|---|
| PubChem CID | 88586817 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | (1E,3E)-1-amino-5-methylhexa-1,3,5-triene-2,3-diol |
| SMILES | C=C(C)/C=C(O)\C(O)=C/N |
| InChI | InChI=1S/C7H11NO2/c1-5(2)3-6(9)7(10)4-8/h3-4,9-10H,1,8H2,2H3/b6-3+,7-4+ |
| InChIKey | WJCRBMPYXKRRHW-XOKGJFMYSA-N |
| XLogP | 1.36 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|