C46H46F4N2O4 — CID 88586916
[(E)-[[11-(2-ethylhexyl)-8-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-5-yl]-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]methylidene]amino] acetate (PubChem CID 88586916) has the molecular formula C46H46F4N2O4 and a molecular weight of 766.88 g/mol. Its IUPAC name is [(E)-[[11-(2-ethylhexyl)-8-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-5-yl]-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]methylidene]amino] acetate.
| Compound Name | [(E)-[[11-(2-ethylhexyl)-8-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-5-yl]-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]methylidene]amino] acetate |
|---|---|
| PubChem CID | 88586916 |
| Molecular Formula | C46H46F4N2O4 |
| Molecular Weight | 766.88 g/mol |
| Exact Mass | 766.34 |
| IUPAC Name | [(E)-[[11-(2-ethylhexyl)-8-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-5-yl]-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]methylidene]amino] acetate |
| SMILES | CCCCC(CC)Cn1c2ccc(C(=O)c3c(C)cc(C)cc3C)cc2c2cc(/C(=N/OC(C)=O)c3ccc(OCC(F)(F)C(F)F)cc3)c3ccccc3c21 |
| InChI | InChI=1S/C46H46F4N2O4/c1-7-9-12-31(8-2)25-52-40-20-17-33(44(54)41-28(4)21-27(3)22-29(41)5)23-37(40)39-24-38(35-13-10-11-14-36(35)43(39)52)42(51-56-30(6)53)32-15-18-34(19-16-32)55-26-46(49,50)45(47)48/h10-11,13-24,31,45H,7-9,12,25-26H2,1-6H3/b51-42+ |
| InChIKey | YEPXMCADSUYLRJ-CFIUJQQCSA-N |
| XLogP | 11.92 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.88 |
| LogP ≤ 5 | 11.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|