C46H46F4N2O5 — CID 88586920
[(Z)-[[11-(2-hexoxyethyl)-5-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-8-yl]-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]methylidene]amino] acetate (PubChem CID 88586920) has the molecular formula C46H46F4N2O5 and a molecular weight of 782.87 g/mol. Its IUPAC name is [(Z)-[[11-(2-hexoxyethyl)-5-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-8-yl]-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]methylidene]amino] acetate.
| Compound Name | [(Z)-[[11-(2-hexoxyethyl)-5-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-8-yl]-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]methylidene]amino] acetate |
|---|---|
| PubChem CID | 88586920 |
| Molecular Formula | C46H46F4N2O5 |
| Molecular Weight | 782.87 g/mol |
| Exact Mass | 782.33 |
| IUPAC Name | [(Z)-[[11-(2-hexoxyethyl)-5-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-8-yl]-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]methylidene]amino] acetate |
| SMILES | CCCCCCOCCn1c2ccc(/C(=N/OC(C)=O)c3ccccc3OCC(F)(F)C(F)F)cc2c2cc(C(=O)c3c(C)cc(C)cc3C)c3ccccc3c21 |
| InChI | InChI=1S/C46H46F4N2O5/c1-6-7-8-13-21-55-22-20-52-39-19-18-32(42(51-57-31(5)53)35-16-11-12-17-40(35)56-27-46(49,50)45(47)48)25-36(39)37-26-38(33-14-9-10-15-34(33)43(37)52)44(54)41-29(3)23-28(2)24-30(41)4/h9-12,14-19,23-26,45H,6-8,13,20-22,27H2,1-5H3/b51-42- |
| InChIKey | KCWFTRAGUIAFNE-OZCIJLEVSA-N |
| XLogP | 11.30 |
| TPSA | 79.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.87 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|