C48H39F4N3O2 — CID 88586992
[11-(cyclohexylmethyl)-5-(4,5-diphenyl-1H-imidazol-2-yl)benzo[a]carbazol-8-yl]-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]methanone (PubChem CID 88586992) has the molecular formula C48H39F4N3O2 and a molecular weight of 765.85 g/mol. Its IUPAC name is [11-(cyclohexylmethyl)-5-(4,5-diphenyl-1H-imidazol-2-yl)benzo[a]carbazol-8-yl]-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]methanone.
| Compound Name | [11-(cyclohexylmethyl)-5-(4,5-diphenyl-1H-imidazol-2-yl)benzo[a]carbazol-8-yl]-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]methanone |
|---|---|
| PubChem CID | 88586992 |
| Molecular Formula | C48H39F4N3O2 |
| Molecular Weight | 765.85 g/mol |
| Exact Mass | 765.30 |
| IUPAC Name | [11-(cyclohexylmethyl)-5-(4,5-diphenyl-1H-imidazol-2-yl)benzo[a]carbazol-8-yl]-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]methanone |
| SMILES | O=C(c1ccc2c(c1)c1cc(-c3nc(-c4ccccc4)c(-c4ccccc4)[nH]3)c3ccccc3c1n2CC1CCCCC1)c1ccccc1OCC(F)(F)C(F)F |
| InChI | InChI=1S/C48H39F4N3O2/c49-47(50)48(51,52)29-57-41-23-13-12-22-36(41)45(56)33-24-25-40-37(26-33)38-27-39(34-20-10-11-21-35(34)44(38)55(40)28-30-14-4-1-5-15-30)46-53-42(31-16-6-2-7-17-31)43(54-46)32-18-8-3-9-19-32/h2-3,6-13,16-27,30,47H,1,4-5,14-15,28-29H2,(H,53,54) |
| InChIKey | MXUYEVDWTFRZIU-UHFFFAOYSA-N |
| XLogP | 12.76 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.85 |
| LogP ≤ 5 | 12.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|