About 5-chloro-1-(2-ethoxyethyl)-N-(6-methylpyrimidin-4-yl)pyrazolo[4,5-d]pyrimidin-7-amine
5-chloro-1-(2-ethoxyethyl)-N-(6-methylpyrimidin-4-yl)pyrazolo[4,5-d]pyrimidin-7-amine (PubChem CID 88587082) has the molecular formula C14H16ClN7O
and a molecular weight of 333.78 g/mol. Its IUPAC name is 5-chloro-1-(2-ethoxyethyl)-N-(6-methylpyrimidin-4-yl)pyrazolo[4,5-d]pyrimidin-7-amine.
Molecular Properties
| Compound Name | 5-chloro-1-(2-ethoxyethyl)-N-(6-methylpyrimidin-4-yl)pyrazolo[4,5-d]pyrimidin-7-amine |
| PubChem CID | 88587082 |
| Molecular Formula | C14H16ClN7O |
| Molecular Weight | 333.78 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 5-chloro-1-(2-ethoxyethyl)-N-(6-methylpyrimidin-4-yl)pyrazolo[4,5-d]pyrimidin-7-amine |
| SMILES | CCOCCn1ncc2nc(Cl)nc(Nc3cc(C)ncn3)c21 |
| InChI | InChI=1S/C14H16ClN7O/c1-3-23-5-4-22-12-10(7-18-22)19-14(15)21-13(12)20-11-6-9(2)16-8-17-11/h6-8H,3-5H2,1-2H3,(H,16,17,19,20,21) |
| InChIKey | WVJITMMIPAYDGM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.78 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-1-(2-ethoxyethyl)-N-(6-methylpyrimidin-4-yl)pyrazolo[4,5-d]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1-(2-ethoxyethyl)-N-(6-methylpyrimidin-4-yl)pyrazolo[4,5-d]pyrimidin-7-amine?
The IUPAC name of 5-chloro-1-(2-ethoxyethyl)-N-(6-methylpyrimidin-4-yl)pyrazolo[4,5-d]pyrimidin-7-amine (CID 88587082) is 5-chloro-1-(2-ethoxyethyl)-N-(6-methylpyrimidin-4-yl)pyrazolo[4,5-d]pyrimidin-7-amine.
What is the SMILES notation for 5-chloro-1-(2-ethoxyethyl)-N-(6-methylpyrimidin-4-yl)pyrazolo[4,5-d]pyrimidin-7-amine?
The canonical SMILES for 5-chloro-1-(2-ethoxyethyl)-N-(6-methylpyrimidin-4-yl)pyrazolo[4,5-d]pyrimidin-7-amine is CCOCCn1ncc2nc(Cl)nc(Nc3cc(C)ncn3)c21.
What is the InChIKey of 5-chloro-1-(2-ethoxyethyl)-N-(6-methylpyrimidin-4-yl)pyrazolo[4,5-d]pyrimidin-7-amine?
The InChIKey is WVJITMMIPAYDGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16ClN7O/c1-3-23-5-4-22-12-10(7-18-22)19-14(15)21-13(12)20-11-6-9(2)16-8-17-11/h6-8H,3-5H2,1-2H3,(H,16,17,19,20,21).
What are the key properties of 5-chloro-1-(2-ethoxyethyl)-N-(6-methylpyrimidin-4-yl)pyrazolo[4,5-d]pyrimidin-7-amine?
5-chloro-1-(2-ethoxyethyl)-N-(6-methylpyrimidin-4-yl)pyrazolo[4,5-d]pyrimidin-7-amine has a molecular weight of 333.78 g/mol, XLogP of 2.36, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1-(2-ethoxyethyl)-N-(6-methylpyrimidin-4-yl)pyrazolo[4,5-d]pyrimidin-7-amine is sourced from PubChem (CID 88587082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).